C12H13Cl — CID 122229914
1-chloro-4-[(3R)-hexa-1,5-dien-3-yl]benzene (PubChem CID 122229914) has the molecular formula C12H13Cl and a molecular weight of 192.69 g/mol. Its IUPAC name is 1-chloro-4-[(3R)-hexa-1,5-dien-3-yl]benzene.
| Compound Name | 1-chloro-4-[(3R)-hexa-1,5-dien-3-yl]benzene |
|---|---|
| PubChem CID | 122229914 |
| Molecular Formula | C12H13Cl |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 1-chloro-4-[(3R)-hexa-1,5-dien-3-yl]benzene |
| SMILES | C=CC[C@H](C=C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13Cl/c1-3-5-10(4-2)11-6-8-12(13)9-7-11/h3-4,6-10H,1-2,5H2/t10-/m0/s1 |
| InChIKey | ZJFWFZOOOAQXFQ-JTQLQIEISA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|