C42H68N12 — CID 102187608
3,11,22,30-tetramethyl-3,11,15,18,22,30,34,37,40,43,46,49-dodecazatricyclo[30.6.6.613,20]pentaconta-1,12,14,18,20,31,33,37,39,43,45,49-dodecaene (PubChem CID 102187608) has the molecular formula C42H68N12 and a molecular weight of 741.09 g/mol. Its IUPAC name is 3,11,22,30-tetramethyl-3,11,15,18,22,30,34,37,40,43,46,49-dodecazatricyclo[30.6.6.613,20]pentaconta-1,12,14,18,20,31,33,37,39,43,45,49-dodecaene.
| Compound Name | 3,11,22,30-tetramethyl-3,11,15,18,22,30,34,37,40,43,46,49-dodecazatricyclo[30.6.6.613,20]pentaconta-1,12,14,18,20,31,33,37,39,43,45,49-dodecaene |
|---|---|
| PubChem CID | 102187608 |
| Molecular Formula | C42H68N12 |
| Molecular Weight | 741.09 g/mol |
| Exact Mass | 740.57 |
| IUPAC Name | 3,11,22,30-tetramethyl-3,11,15,18,22,30,34,37,40,43,46,49-dodecazatricyclo[30.6.6.613,20]pentaconta-1,12,14,18,20,31,33,37,39,43,45,49-dodecaene |
| SMILES | CN1/C=C2\C=N/CC/N=C\C(=C\N(C)CCCCCCCN(C)/C=C3/C=N\CC/N=C/C(=C/N(C)CCCCCCC1)/C=N\CC/N=C/3)\C=N\CC/N=C\2 |
| InChI | InChI=1S/C42H68N12/c1-51-23-11-7-5-8-12-24-52(2)36-41-31-47-19-21-49-33-42(34-50-22-20-48-32-41)38-54(4)26-14-10-6-9-13-25-53(3)37-40-29-45-17-15-43-27-39(35-51)28-44-16-18-46-30-40/h27-38H,5-26H2,1-4H3/b39-35-,40-37-,41-36-,42-38+,43-27-,44-28-,45-29-,46-30+,47-31-,48-32+,49-33+,50-34- |
| InChIKey | VHPSDBNIEHSCEP-DQICJNMUSA-N |
| XLogP | 5.76 |
| TPSA | 111.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.09 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |