C28H50N6 — CID 102343701
N-butyl-N-[[13-[(dibutylamino)methylidene]-1,4,8,11-tetrazacyclotetradeca-4,7,11,14-tetraen-6-ylidene]methyl]butan-1-amine (PubChem CID 102343701) has the molecular formula C28H50N6 and a molecular weight of 470.75 g/mol. Its IUPAC name is N-butyl-N-[[13-[(dibutylamino)methylidene]-1,4,8,11-tetrazacyclotetradeca-4,7,11,14-tetraen-6-ylidene]methyl]butan-1-amine.
| Compound Name | N-butyl-N-[[13-[(dibutylamino)methylidene]-1,4,8,11-tetrazacyclotetradeca-4,7,11,14-tetraen-6-ylidene]methyl]butan-1-amine |
|---|---|
| PubChem CID | 102343701 |
| Molecular Formula | C28H50N6 |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 470.41 |
| IUPAC Name | N-butyl-N-[[13-[(dibutylamino)methylidene]-1,4,8,11-tetrazacyclotetradeca-4,7,11,14-tetraen-6-ylidene]methyl]butan-1-amine |
| SMILES | CCCCN(C=C1/C=N/CC/N=C/C(=CN(CCCC)CCCC)/C=N/CC/N=C/1)CCCC |
| InChI | InChI=1S/C28H50N6/c1-5-9-17-33(18-10-6-2)25-27-21-29-13-15-31-23-28(24-32-16-14-30-22-27)26-34(19-11-7-3)20-12-8-4/h21-26H,5-20H2,1-4H3/b27-25-,28-26+,29-21+,30-22+,31-23+,32-24+ |
| InChIKey | IAWWPBLESPTAAK-UBALRWLNSA-N |
| XLogP | 5.86 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |