C29H37NO6 — CID 102188045
2-[bis(3,4-diethoxyphenyl)methyl]-4,5-dimethoxyaniline (PubChem CID 102188045) has the molecular formula C29H37NO6 and a molecular weight of 495.62 g/mol. Its IUPAC name is 2-[bis(3,4-diethoxyphenyl)methyl]-4,5-dimethoxyaniline.
| Compound Name | 2-[bis(3,4-diethoxyphenyl)methyl]-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 102188045 |
| Molecular Formula | C29H37NO6 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 2-[bis(3,4-diethoxyphenyl)methyl]-4,5-dimethoxyaniline |
| SMILES | CCOc1ccc(C(c2ccc(OCC)c(OCC)c2)c2cc(OC)c(OC)cc2N)cc1OCC |
| InChI | InChI=1S/C29H37NO6/c1-7-33-23-13-11-19(15-27(23)35-9-3)29(21-17-25(31-5)26(32-6)18-22(21)30)20-12-14-24(34-8-2)28(16-20)36-10-4/h11-18,29H,7-10,30H2,1-6H3 |
| InChIKey | URNOUKTTYOKRMI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|