C16H17N3O2 — CID 102189066
2-(benzotriazol-2-yl)-4-tert-butylbenzene-1,3-diol (PubChem CID 102189066) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-4-tert-butylbenzene-1,3-diol.
| Compound Name | 2-(benzotriazol-2-yl)-4-tert-butylbenzene-1,3-diol |
|---|---|
| PubChem CID | 102189066 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-(benzotriazol-2-yl)-4-tert-butylbenzene-1,3-diol |
| SMILES | CC(C)(C)c1ccc(O)c(-n2nc3ccccc3n2)c1O |
| InChI | InChI=1S/C16H17N3O2/c1-16(2,3)10-8-9-13(20)14(15(10)21)19-17-11-6-4-5-7-12(11)18-19/h4-9,20-21H,1-3H3 |
| InChIKey | WRCPUAHJWBTSEX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |