C17H20N4O — CID 152674943
4-(aminomethyl)-2-(benzotriazol-2-yl)-6-tert-butylphenol (PubChem CID 152674943) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-(aminomethyl)-2-(benzotriazol-2-yl)-6-tert-butylphenol.
| Compound Name | 4-(aminomethyl)-2-(benzotriazol-2-yl)-6-tert-butylphenol |
|---|---|
| PubChem CID | 152674943 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 4-(aminomethyl)-2-(benzotriazol-2-yl)-6-tert-butylphenol |
| SMILES | CC(C)(C)c1cc(CN)cc(-n2nc3ccccc3n2)c1O |
| InChI | InChI=1S/C17H20N4O/c1-17(2,3)12-8-11(10-18)9-15(16(12)22)21-19-13-6-4-5-7-14(13)20-21/h4-9,22H,10,18H2,1-3H3 |
| InChIKey | ZMIFMGWXQVPVDX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |