C25H33N3O6 — CID 87404296
2-[2-(2-hydroxyethoxy)ethoxy]ethyl 3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]propanoate (PubChem CID 87404296) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]propanoate.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]propanoate |
|---|---|
| PubChem CID | 87404296 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]propanoate |
| SMILES | CC(C)(C)c1cc(CCC(=O)OCCOCCOCCO)cc(-n2nc3ccccc3n2)c1O |
| InChI | InChI=1S/C25H33N3O6/c1-25(2,3)19-16-18(8-9-23(30)34-15-14-33-13-12-32-11-10-29)17-22(24(19)31)28-26-20-6-4-5-7-21(20)27-28/h4-7,16-17,29,31H,8-15H2,1-3H3 |
| InChIKey | QYEGQKRKJQPJMU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|