C21H25N3O6 — CID 146305658
5-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]-1,1,1,2-tetrahydroxypentan-3-one (PubChem CID 146305658) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is 5-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]-1,1,1,2-tetrahydroxypentan-3-one.
| Compound Name | 5-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]-1,1,1,2-tetrahydroxypentan-3-one |
|---|---|
| PubChem CID | 146305658 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 5-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]-1,1,1,2-tetrahydroxypentan-3-one |
| SMILES | CC(C)(C)c1cc(CCC(=O)C(O)C(O)(O)O)cc(-n2nc3ccccc3n2)c1O |
| InChI | InChI=1S/C21H25N3O6/c1-20(2,3)13-10-12(8-9-17(25)19(27)21(28,29)30)11-16(18(13)26)24-22-14-6-4-5-7-15(14)23-24/h4-7,10-11,19,26-30H,8-9H2,1-3H3 |
| InChIKey | BGJQWCWNNVEBNW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|