C17H32O4Si — CID 102190482
[(2S,4S)-2-[tri(propan-2-yl)silyloxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate (PubChem CID 102190482) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is [(2S,4S)-2-[tri(propan-2-yl)silyloxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate.
| Compound Name | [(2S,4S)-2-[tri(propan-2-yl)silyloxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate |
|---|---|
| PubChem CID | 102190482 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | [(2S,4S)-2-[tri(propan-2-yl)silyloxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=CO[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C17H32O4Si/c1-12(2)22(13(3)4,14(5)6)20-11-17-10-16(8-9-19-17)21-15(7)18/h8-9,12-14,16-17H,10-11H2,1-7H3/t16-,17+/m1/s1 |
| InChIKey | ITQZRCLAFDLQIA-SJORKVTESA-N |
| XLogP | 4.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|