C16H28O5Si — CID 72811302
(2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl) acetate (PubChem CID 72811302) has the molecular formula C16H28O5Si and a molecular weight of 328.48 g/mol. Its IUPAC name is (2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl) acetate.
| Compound Name | (2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl) acetate |
|---|---|
| PubChem CID | 72811302 |
| Molecular Formula | C16H28O5Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl) acetate |
| SMILES | CC(=O)OC1C=COC2CO[Si](C(C)(C)C)(C(C)(C)C)OC12 |
| InChI | InChI=1S/C16H28O5Si/c1-11(17)20-12-8-9-18-13-10-19-22(15(2,3)4,16(5,6)7)21-14(12)13/h8-9,12-14H,10H2,1-7H3 |
| InChIKey | WXINOKCQXHFVRH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|