C12H10F6O4S2 — CID 102192017
[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]benzene (PubChem CID 102192017) has the molecular formula C12H10F6O4S2 and a molecular weight of 396.33 g/mol. Its IUPAC name is [(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]benzene.
| Compound Name | [(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]benzene |
|---|---|
| PubChem CID | 102192017 |
| Molecular Formula | C12H10F6O4S2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | [(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]benzene |
| SMILES | O=S(=O)(C(C/C=C/c1ccccc1)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F6O4S2/c13-11(14,15)23(19,20)10(24(21,22)12(16,17)18)8-4-7-9-5-2-1-3-6-9/h1-7,10H,8H2/b7-4+ |
| InChIKey | FGYMRADOTQEAOH-QPJJXVBHSA-N |
| XLogP | 3.29 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |