C15H28O8P- — CID 102193562
[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] 3,7-dimethyloct-6-enyl phosphate (PubChem CID 102193562) has the molecular formula C15H28O8P- and a molecular weight of 367.36 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] 3,7-dimethyloct-6-enyl phosphate.
| Compound Name | [(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] 3,7-dimethyloct-6-enyl phosphate |
|---|---|
| PubChem CID | 102193562 |
| Molecular Formula | C15H28O8P- |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | [(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] 3,7-dimethyloct-6-enyl phosphate |
| SMILES | CC(C)=CCCC(C)CCOP(=O)([O-])O[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H29O8P/c1-10(2)5-4-6-11(3)7-8-21-24(19,20)23-15-14(18)13(17)12(9-16)22-15/h5,11-18H,4,6-9H2,1-3H3,(H,19,20)/p-1/t11?,12-,13-,14+,15+/m1/s1 |
| InChIKey | KYKJKAHTFOGNBN-IWNKAIHXSA-M |
| XLogP | 0.70 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|