C16H32O12P2 — CID 90664072
[[(3R)-3,7-dimethyloct-6-enoxy]-hydroxyphosphoryl] [(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate (PubChem CID 90664072) has the molecular formula C16H32O12P2 and a molecular weight of 478.37 g/mol. Its IUPAC name is [[(3R)-3,7-dimethyloct-6-enoxy]-hydroxyphosphoryl] [(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate.
| Compound Name | [[(3R)-3,7-dimethyloct-6-enoxy]-hydroxyphosphoryl] [(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 90664072 |
| Molecular Formula | C16H32O12P2 |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | [[(3R)-3,7-dimethyloct-6-enoxy]-hydroxyphosphoryl] [(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate |
| SMILES | CC(C)=CCC[C@@H](C)CCOP(=O)(O)OP(=O)(O)O[C@H]1O[C@@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H32O12P2/c1-10(2)5-4-6-11(3)7-8-25-29(21,22)28-30(23,24)27-16-15(20)14(19)13(18)12(9-17)26-16/h5,11-20H,4,6-9H2,1-3H3,(H,21,22)(H,23,24)/t11-,12+,13-,14+,15+,16-/m1/s1 |
| InChIKey | FOVRPIIDNFSPGB-YUDUXTHKSA-N |
| XLogP | 0.81 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|