C33H26O12 — CID 102194569
(2R,3R,4R)-2-(3,4-dihydroxyphenyl)-4-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-3-hydroxy-3,4-dihydro-2H-pyrano[2,3-f]chromen-8-one (PubChem CID 102194569) has the molecular formula C33H26O12 and a molecular weight of 614.56 g/mol. Its IUPAC name is (2R,3R,4R)-2-(3,4-dihydroxyphenyl)-4-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-3-hydroxy-3,4-dihydro-2H-pyrano[2,3-f]chromen-8-one.
| Compound Name | (2R,3R,4R)-2-(3,4-dihydroxyphenyl)-4-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-3-hydroxy-3,4-dihydro-2H-pyrano[2,3-f]chromen-8-one |
|---|---|
| PubChem CID | 102194569 |
| Molecular Formula | C33H26O12 |
| Molecular Weight | 614.56 g/mol |
| Exact Mass | 614.14 |
| IUPAC Name | (2R,3R,4R)-2-(3,4-dihydroxyphenyl)-4-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-3-hydroxy-3,4-dihydro-2H-pyrano[2,3-f]chromen-8-one |
| SMILES | O=c1ccc2c3c(ccc2o1)[C@H](c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)C2)[C@@H](O)[C@@H](c1ccc(O)c(O)c1)O3 |
| InChI | InChI=1S/C33H26O12/c34-18-5-1-13(9-21(18)37)30-24(40)11-17-20(36)12-23(39)28(33(17)44-30)27-16-3-7-25-15(4-8-26(41)43-25)32(16)45-31(29(27)42)14-2-6-19(35)22(38)10-14/h1-10,12,24,27,29-31,34-40,42H,11H2/t24-,27-,29-,30-,31-/m1/s1 |
| InChIKey | RTVLJCFSGDPCQF-NVYOEXHQSA-N |
| XLogP | 3.69 |
| TPSA | 210.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|