C25H23NO3 — CID 102196240
methyl 1-benzyl-2-(3-methoxyphenyl)-2H-quinoline-4-carboxylate (PubChem CID 102196240) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is methyl 1-benzyl-2-(3-methoxyphenyl)-2H-quinoline-4-carboxylate.
| Compound Name | methyl 1-benzyl-2-(3-methoxyphenyl)-2H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 102196240 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | methyl 1-benzyl-2-(3-methoxyphenyl)-2H-quinoline-4-carboxylate |
| SMILES | COC(=O)C1=CC(c2cccc(OC)c2)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H23NO3/c1-28-20-12-8-11-19(15-20)24-16-22(25(27)29-2)21-13-6-7-14-23(21)26(24)17-18-9-4-3-5-10-18/h3-16,24H,17H2,1-2H3 |
| InChIKey | ODVIUGHFVAVEDD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |