C29H26N2O2 — CID 126183550
(2R)-1-benzyl-2-(3-methoxyphenyl)-3-(4-methylphenyl)-2H-quinazolin-4-one (PubChem CID 126183550) has the molecular formula C29H26N2O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is (2R)-1-benzyl-2-(3-methoxyphenyl)-3-(4-methylphenyl)-2H-quinazolin-4-one.
| Compound Name | (2R)-1-benzyl-2-(3-methoxyphenyl)-3-(4-methylphenyl)-2H-quinazolin-4-one |
|---|---|
| PubChem CID | 126183550 |
| Molecular Formula | C29H26N2O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (2R)-1-benzyl-2-(3-methoxyphenyl)-3-(4-methylphenyl)-2H-quinazolin-4-one |
| SMILES | COc1cccc([C@@H]2N(Cc3ccccc3)c3ccccc3C(=O)N2c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C29H26N2O2/c1-21-15-17-24(18-16-21)31-28(23-11-8-12-25(19-23)33-2)30(20-22-9-4-3-5-10-22)27-14-7-6-13-26(27)29(31)32/h3-19,28H,20H2,1-2H3/t28-/m1/s1 |
| InChIKey | GQFFXFMSMKMPNI-MUUNZHRXSA-N |
| XLogP | 6.37 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |