C30H26N2O3 — CID 126174117
methyl 4-[(2R)-1-benzyl-3-(4-methylphenyl)-4-oxo-2H-quinazolin-2-yl]benzoate (PubChem CID 126174117) has the molecular formula C30H26N2O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is methyl 4-[(2R)-1-benzyl-3-(4-methylphenyl)-4-oxo-2H-quinazolin-2-yl]benzoate.
| Compound Name | methyl 4-[(2R)-1-benzyl-3-(4-methylphenyl)-4-oxo-2H-quinazolin-2-yl]benzoate |
|---|---|
| PubChem CID | 126174117 |
| Molecular Formula | C30H26N2O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | methyl 4-[(2R)-1-benzyl-3-(4-methylphenyl)-4-oxo-2H-quinazolin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2N(Cc3ccccc3)c3ccccc3C(=O)N2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H26N2O3/c1-21-12-18-25(19-13-21)32-28(23-14-16-24(17-15-23)30(34)35-2)31(20-22-8-4-3-5-9-22)27-11-7-6-10-26(27)29(32)33/h3-19,28H,20H2,1-2H3/t28-/m1/s1 |
| InChIKey | NXOBBNZFZCHPHN-MUUNZHRXSA-N |
| XLogP | 6.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |