C32H32N2O2 — CID 126172204
(2S)-1-benzyl-3-(4-methylphenyl)-2-[4-(2-methylpropoxy)phenyl]-2H-quinazolin-4-one (PubChem CID 126172204) has the molecular formula C32H32N2O2 and a molecular weight of 476.62 g/mol. Its IUPAC name is (2S)-1-benzyl-3-(4-methylphenyl)-2-[4-(2-methylpropoxy)phenyl]-2H-quinazolin-4-one.
| Compound Name | (2S)-1-benzyl-3-(4-methylphenyl)-2-[4-(2-methylpropoxy)phenyl]-2H-quinazolin-4-one |
|---|---|
| PubChem CID | 126172204 |
| Molecular Formula | C32H32N2O2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | (2S)-1-benzyl-3-(4-methylphenyl)-2-[4-(2-methylpropoxy)phenyl]-2H-quinazolin-4-one |
| SMILES | Cc1ccc(N2C(=O)c3ccccc3N(Cc3ccccc3)[C@@H]2c2ccc(OCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H32N2O2/c1-23(2)22-36-28-19-15-26(16-20-28)31-33(21-25-9-5-4-6-10-25)30-12-8-7-11-29(30)32(35)34(31)27-17-13-24(3)14-18-27/h4-20,23,31H,21-22H2,1-3H3/t31-/m0/s1 |
| InChIKey | AYEBRSPGRTYEPP-HKBQPEDESA-N |
| XLogP | 7.40 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |