C31H28N2O4 — CID 126176054
methyl 2-[4-[(2S)-1-benzyl-3-(4-methylphenyl)-4-oxo-2H-quinazolin-2-yl]phenoxy]acetate (PubChem CID 126176054) has the molecular formula C31H28N2O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is methyl 2-[4-[(2S)-1-benzyl-3-(4-methylphenyl)-4-oxo-2H-quinazolin-2-yl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(2S)-1-benzyl-3-(4-methylphenyl)-4-oxo-2H-quinazolin-2-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 126176054 |
| Molecular Formula | C31H28N2O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | methyl 2-[4-[(2S)-1-benzyl-3-(4-methylphenyl)-4-oxo-2H-quinazolin-2-yl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc([C@H]2N(Cc3ccccc3)c3ccccc3C(=O)N2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H28N2O4/c1-22-12-16-25(17-13-22)33-30(24-14-18-26(19-15-24)37-21-29(34)36-2)32(20-23-8-4-3-5-9-23)28-11-7-6-10-27(28)31(33)35/h3-19,30H,20-21H2,1-2H3/t30-/m0/s1 |
| InChIKey | ZWPIYJBSRSDGJL-PMERELPUSA-N |
| XLogP | 5.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |