C31H28N2O2S — CID 126174635
(2S)-1-benzyl-3-(4-methylphenyl)-2-[4-(thietan-3-yloxy)phenyl]-2H-quinazolin-4-one (PubChem CID 126174635) has the molecular formula C31H28N2O2S and a molecular weight of 492.64 g/mol. Its IUPAC name is (2S)-1-benzyl-3-(4-methylphenyl)-2-[4-(thietan-3-yloxy)phenyl]-2H-quinazolin-4-one.
| Compound Name | (2S)-1-benzyl-3-(4-methylphenyl)-2-[4-(thietan-3-yloxy)phenyl]-2H-quinazolin-4-one |
|---|---|
| PubChem CID | 126174635 |
| Molecular Formula | C31H28N2O2S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | (2S)-1-benzyl-3-(4-methylphenyl)-2-[4-(thietan-3-yloxy)phenyl]-2H-quinazolin-4-one |
| SMILES | Cc1ccc(N2C(=O)c3ccccc3N(Cc3ccccc3)[C@@H]2c2ccc(OC3CSC3)cc2)cc1 |
| InChI | InChI=1S/C31H28N2O2S/c1-22-11-15-25(16-12-22)33-30(24-13-17-26(18-14-24)35-27-20-36-21-27)32(19-23-7-3-2-4-8-23)29-10-6-5-9-28(29)31(33)34/h2-18,27,30H,19-21H2,1H3/t30-/m0/s1 |
| InChIKey | QSYNSBXTOFRSQQ-PMERELPUSA-N |
| XLogP | 6.86 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |