C27H20Cl2N2O — CID 126346502
(2R)-1-benzyl-2-(3,4-dichlorophenyl)-3-phenyl-2H-quinazolin-4-one (PubChem CID 126346502) has the molecular formula C27H20Cl2N2O and a molecular weight of 459.38 g/mol. Its IUPAC name is (2R)-1-benzyl-2-(3,4-dichlorophenyl)-3-phenyl-2H-quinazolin-4-one.
| Compound Name | (2R)-1-benzyl-2-(3,4-dichlorophenyl)-3-phenyl-2H-quinazolin-4-one |
|---|---|
| PubChem CID | 126346502 |
| Molecular Formula | C27H20Cl2N2O |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | (2R)-1-benzyl-2-(3,4-dichlorophenyl)-3-phenyl-2H-quinazolin-4-one |
| SMILES | O=C1c2ccccc2N(Cc2ccccc2)[C@@H](c2ccc(Cl)c(Cl)c2)N1c1ccccc1 |
| InChI | InChI=1S/C27H20Cl2N2O/c28-23-16-15-20(17-24(23)29)26-30(18-19-9-3-1-4-10-19)25-14-8-7-13-22(25)27(32)31(26)21-11-5-2-6-12-21/h1-17,26H,18H2/t26-/m1/s1 |
| InChIKey | VWALRBIRALZRBO-AREMUKBSSA-N |
| XLogP | 7.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |