C28H22N2O3 — CID 126348937
2-[(2R)-1-benzyl-4-oxo-3-phenyl-2H-quinazolin-2-yl]benzoic acid (PubChem CID 126348937) has the molecular formula C28H22N2O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[(2R)-1-benzyl-4-oxo-3-phenyl-2H-quinazolin-2-yl]benzoic acid.
| Compound Name | 2-[(2R)-1-benzyl-4-oxo-3-phenyl-2H-quinazolin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126348937 |
| Molecular Formula | C28H22N2O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-[(2R)-1-benzyl-4-oxo-3-phenyl-2H-quinazolin-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1[C@@H]1N(Cc2ccccc2)c2ccccc2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C28H22N2O3/c31-27-24-17-9-10-18-25(24)29(19-20-11-3-1-4-12-20)26(30(27)21-13-5-2-6-14-21)22-15-7-8-16-23(22)28(32)33/h1-18,26H,19H2,(H,32,33)/t26-/m1/s1 |
| InChIKey | FKQZQBGIIGKHTL-AREMUKBSSA-N |
| XLogP | 5.75 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |