C35H28N2O3 — CID 126187977
[4-[(2R)-1-benzyl-3-(4-methylphenyl)-4-oxo-2H-quinazolin-2-yl]phenyl] benzoate (PubChem CID 126187977) has the molecular formula C35H28N2O3 and a molecular weight of 524.62 g/mol. Its IUPAC name is [4-[(2R)-1-benzyl-3-(4-methylphenyl)-4-oxo-2H-quinazolin-2-yl]phenyl] benzoate.
| Compound Name | [4-[(2R)-1-benzyl-3-(4-methylphenyl)-4-oxo-2H-quinazolin-2-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 126187977 |
| Molecular Formula | C35H28N2O3 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | [4-[(2R)-1-benzyl-3-(4-methylphenyl)-4-oxo-2H-quinazolin-2-yl]phenyl] benzoate |
| SMILES | Cc1ccc(N2C(=O)c3ccccc3N(Cc3ccccc3)[C@H]2c2ccc(OC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C35H28N2O3/c1-25-16-20-29(21-17-25)37-33(27-18-22-30(23-19-27)40-35(39)28-12-6-3-7-13-28)36(24-26-10-4-2-5-11-26)32-15-9-8-14-31(32)34(37)38/h2-23,33H,24H2,1H3/t33-/m1/s1 |
| InChIKey | FFRNZHLMVLEFCL-MGBGTMOVSA-N |
| XLogP | 7.58 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|