C11H8O3 — CID 10219736
(2S,8R)-5-oxatetracyclo[7.2.1.02,8.04,6]dodeca-4(6),10-diene-3,7-dione (PubChem CID 10219736) has the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. Its IUPAC name is (2S,8R)-5-oxatetracyclo[7.2.1.02,8.04,6]dodeca-4(6),10-diene-3,7-dione.
| Compound Name | (2S,8R)-5-oxatetracyclo[7.2.1.02,8.04,6]dodeca-4(6),10-diene-3,7-dione |
|---|---|
| PubChem CID | 10219736 |
| Molecular Formula | C11H8O3 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | (2S,8R)-5-oxatetracyclo[7.2.1.02,8.04,6]dodeca-4(6),10-diene-3,7-dione |
| SMILES | O=C1C2=C(O2)C(=O)[C@H]2C3C=CC(C3)[C@@H]12 |
| InChI | InChI=1S/C11H8O3/c12-8-6-4-1-2-5(3-4)7(6)9(13)11-10(8)14-11/h1-2,4-7H,3H2/t4?,5?,6-,7+ |
| InChIKey | ARUKQRCBTMQCQL-CYDAGYADSA-N |
| XLogP | 0.82 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|