C14H16O4 — CID 10879495
(1R,2S,7R,8S)-4,5-dimethoxy-2-methyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 10879495) has the molecular formula C14H16O4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (1R,2S,7R,8S)-4,5-dimethoxy-2-methyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | (1R,2S,7R,8S)-4,5-dimethoxy-2-methyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 10879495 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (1R,2S,7R,8S)-4,5-dimethoxy-2-methyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | COC1=[13C](OC)C(=O)[C@@H]2[C@@H]3C=C[C@@H](C3)[C@]2(C)C1=O |
| InChI | InChI=1S/C14H16O4/c1-14-8-5-4-7(6-8)9(14)10(15)11(17-2)12(18-3)13(14)16/h4-5,7-9H,6H2,1-3H3/t7-,8+,9+,14+/m1/s1/i11+1 |
| InChIKey | IXWCWIVRHATZNI-WWMHQVOHSA-N |
| XLogP | 1.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|