C30H30O8 — CID 164666349
(1R,2S,3S,8S,12S,17S)-2-[(2E,4E)-hexa-2,4-dienoyl]-6,15-dimethoxy-5,14,17-trimethylpentacyclo[9.5.3.01,12.03,8.08,12]nonadeca-5,11(19),14-triene-4,7,10,13,16-pentone (PubChem CID 164666349) has the molecular formula C30H30O8 and a molecular weight of 518.56 g/mol. Its IUPAC name is (1R,2S,3S,8S,12S,17S)-2-[(2E,4E)-hexa-2,4-dienoyl]-6,15-dimethoxy-5,14,17-trimethylpentacyclo[9.5.3.01,12.03,8.08,12]nonadeca-5,11(19),14-triene-4,7,10,13,16-pentone.
| Compound Name | (1R,2S,3S,8S,12S,17S)-2-[(2E,4E)-hexa-2,4-dienoyl]-6,15-dimethoxy-5,14,17-trimethylpentacyclo[9.5.3.01,12.03,8.08,12]nonadeca-5,11(19),14-triene-4,7,10,13,16-pentone |
|---|---|
| PubChem CID | 164666349 |
| Molecular Formula | C30H30O8 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | (1R,2S,3S,8S,12S,17S)-2-[(2E,4E)-hexa-2,4-dienoyl]-6,15-dimethoxy-5,14,17-trimethylpentacyclo[9.5.3.01,12.03,8.08,12]nonadeca-5,11(19),14-triene-4,7,10,13,16-pentone |
| SMILES | C/C=C/C=C/C(=O)[C@H]1[C@@H]2C(=O)C(C)=C(OC)C(=O)[C@@]23CC(=O)C2=CC[C@H](C)[C@@]14C(=O)C(OC)=C(C)C(=O)[C@]243 |
| InChI | InChI=1S/C30H30O8/c1-7-8-9-10-18(31)20-21-22(33)15(3)23(37-5)26(35)28(21)13-19(32)17-12-11-14(2)29(20)27(36)24(38-6)16(4)25(34)30(17,28)29/h7-10,12,14,20-21H,11,13H2,1-6H3/b8-7+,10-9+/t14-,20-,21+,28+,29-,30-/m0/s1 |
| InChIKey | AWTOWIMJCDPBJD-FLCIQADXSA-N |
| XLogP | 2.98 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|