C30H30O8 — CID 164666346
(4bS,8aS,9S)-9-[(2E,4E)-hexa-2,4-dienoyl]-2,6-dimethoxy-3,7-dimethyl-4b-[(3E,5E)-2-oxohepta-3,5-dienyl]-8a,9-dihydrofluorene-1,4,5,8-tetrone (PubChem CID 164666346) has the molecular formula C30H30O8 and a molecular weight of 518.56 g/mol. Its IUPAC name is (4bS,8aS,9S)-9-[(2E,4E)-hexa-2,4-dienoyl]-2,6-dimethoxy-3,7-dimethyl-4b-[(3E,5E)-2-oxohepta-3,5-dienyl]-8a,9-dihydrofluorene-1,4,5,8-tetrone.
| Compound Name | (4bS,8aS,9S)-9-[(2E,4E)-hexa-2,4-dienoyl]-2,6-dimethoxy-3,7-dimethyl-4b-[(3E,5E)-2-oxohepta-3,5-dienyl]-8a,9-dihydrofluorene-1,4,5,8-tetrone |
|---|---|
| PubChem CID | 164666346 |
| Molecular Formula | C30H30O8 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | (4bS,8aS,9S)-9-[(2E,4E)-hexa-2,4-dienoyl]-2,6-dimethoxy-3,7-dimethyl-4b-[(3E,5E)-2-oxohepta-3,5-dienyl]-8a,9-dihydrofluorene-1,4,5,8-tetrone |
| SMILES | C/C=C/C=C/C(=O)C[C@]12C(=O)C(OC)=C(C)C(=O)[C@H]1[C@H](C(=O)/C=C/C=C/C)C1=C2C(=O)C(C)=C(OC)C1=O |
| InChI | InChI=1S/C30H30O8/c1-7-9-11-13-18(31)15-30-22(25(34)17(4)28(38-6)29(30)36)20(19(32)14-12-10-8-2)21-23(30)24(33)16(3)27(37-5)26(21)35/h7-14,20,22H,15H2,1-6H3/b9-7+,10-8+,13-11+,14-12+/t20-,22-,30+/m1/s1 |
| InChIKey | SIEDXVGUZNMSRD-UPUCNKOXSA-N |
| XLogP | 3.45 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|