C28H26O8 — CID 135035640
(4bS,8aS,9S)-9-[(2E,4E)-hexa-2,4-dienoyl]-4,6-dihydroxy-3,7-dimethyl-4b-[(3E,5E)-2-oxohepta-3,5-dienyl]-8a,9-dihydrofluorene-1,2,5,8-tetrone (PubChem CID 135035640) has the molecular formula C28H26O8 and a molecular weight of 490.51 g/mol. Its IUPAC name is (4bS,8aS,9S)-9-[(2E,4E)-hexa-2,4-dienoyl]-4,6-dihydroxy-3,7-dimethyl-4b-[(3E,5E)-2-oxohepta-3,5-dienyl]-8a,9-dihydrofluorene-1,2,5,8-tetrone.
| Compound Name | (4bS,8aS,9S)-9-[(2E,4E)-hexa-2,4-dienoyl]-4,6-dihydroxy-3,7-dimethyl-4b-[(3E,5E)-2-oxohepta-3,5-dienyl]-8a,9-dihydrofluorene-1,2,5,8-tetrone |
|---|---|
| PubChem CID | 135035640 |
| Molecular Formula | C28H26O8 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | (4bS,8aS,9S)-9-[(2E,4E)-hexa-2,4-dienoyl]-4,6-dihydroxy-3,7-dimethyl-4b-[(3E,5E)-2-oxohepta-3,5-dienyl]-8a,9-dihydrofluorene-1,2,5,8-tetrone |
| SMILES | C/C=C/C=C/C(=O)C[C@]12C(=O)C(O)=C(C)C(=O)[C@H]1[C@H](C(=O)/C=C/C=C/C)C1=C2C(O)=C(C)C(=O)C1=O |
| InChI | InChI=1S/C28H26O8/c1-5-7-9-11-16(29)13-28-20(23(32)15(4)25(34)27(28)36)18(17(30)12-10-8-6-2)19-21(28)22(31)14(3)24(33)26(19)35/h5-12,18,20,31,34H,13H2,1-4H3/b7-5+,8-6+,11-9+,12-10+/t18-,20-,28+/m1/s1 |
| InChIKey | UMQRBUAYMUKJFU-YFOKIFIXSA-N |
| XLogP | 3.28 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|