C21H28O3 — CID 56958630
(4bS,8aR)-3-methoxy-4b,8,8-trimethyl-9-methylidene-2-propan-2-yl-5,6,7,8a-tetrahydrofluorene-1,4-dione (PubChem CID 56958630) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (4bS,8aR)-3-methoxy-4b,8,8-trimethyl-9-methylidene-2-propan-2-yl-5,6,7,8a-tetrahydrofluorene-1,4-dione.
| Compound Name | (4bS,8aR)-3-methoxy-4b,8,8-trimethyl-9-methylidene-2-propan-2-yl-5,6,7,8a-tetrahydrofluorene-1,4-dione |
|---|---|
| PubChem CID | 56958630 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (4bS,8aR)-3-methoxy-4b,8,8-trimethyl-9-methylidene-2-propan-2-yl-5,6,7,8a-tetrahydrofluorene-1,4-dione |
| SMILES | C=C1C2=C(C(=O)C(OC)=C(C(C)C)C2=O)[C@@]2(C)CCCC(C)(C)[C@H]12 |
| InChI | InChI=1S/C21H28O3/c1-11(2)13-16(22)14-12(3)19-20(4,5)9-8-10-21(19,6)15(14)17(23)18(13)24-7/h11,19H,3,8-10H2,1-2,4-7H3/t19-,21+/m0/s1 |
| InChIKey | RYAADBYDKNWWKR-PZJWPPBQSA-N |
| XLogP | 4.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|