C28H26O8 — CID 135035070
(1R,2S,3S,8S,11R,12S,17S)-2-[(2E,4E)-hexa-2,4-dienoyl]-6,15-dihydroxy-5,14,17-trimethylpentacyclo[9.5.3.01,12.03,8.08,12]nonadeca-5,14,18-triene-4,7,10,13,16-pentone (PubChem CID 135035070) has the molecular formula C28H26O8 and a molecular weight of 490.51 g/mol. Its IUPAC name is (1R,2S,3S,8S,11R,12S,17S)-2-[(2E,4E)-hexa-2,4-dienoyl]-6,15-dihydroxy-5,14,17-trimethylpentacyclo[9.5.3.01,12.03,8.08,12]nonadeca-5,14,18-triene-4,7,10,13,16-pentone.
| Compound Name | (1R,2S,3S,8S,11R,12S,17S)-2-[(2E,4E)-hexa-2,4-dienoyl]-6,15-dihydroxy-5,14,17-trimethylpentacyclo[9.5.3.01,12.03,8.08,12]nonadeca-5,14,18-triene-4,7,10,13,16-pentone |
|---|---|
| PubChem CID | 135035070 |
| Molecular Formula | C28H26O8 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | (1R,2S,3S,8S,11R,12S,17S)-2-[(2E,4E)-hexa-2,4-dienoyl]-6,15-dihydroxy-5,14,17-trimethylpentacyclo[9.5.3.01,12.03,8.08,12]nonadeca-5,14,18-triene-4,7,10,13,16-pentone |
| SMILES | C/C=C/C=C/C(=O)[C@H]1[C@@H]2C(=O)C(C)=C(O)C(=O)[C@@]23CC(=O)[C@@H]2C=C[C@H](C)[C@@]14C(=O)C(O)=C(C)C(=O)[C@]243 |
| InChI | InChI=1S/C28H26O8/c1-5-6-7-8-16(29)18-19-20(31)13(3)21(32)24(35)26(19)11-17(30)15-10-9-12(2)27(18)25(36)22(33)14(4)23(34)28(15,26)27/h5-10,12,15,18-19,32-33H,11H2,1-4H3/b6-5+,8-7+/t12-,15-,18-,19+,26+,27-,28-/m0/s1 |
| InChIKey | IDZHUFLKWPARBE-REDGVJPFSA-N |
| XLogP | 2.66 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|