C20H24O3 — CID 134932462
(1R,5R,8R,9R,11R,12S,14S)-3-hydroxy-1,5,9-trimethyl-14-prop-1-en-2-yltetracyclo[9.2.1.04,12.08,12]tetradeca-3,6-diene-2,13-dione (PubChem CID 134932462) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (1R,5R,8R,9R,11R,12S,14S)-3-hydroxy-1,5,9-trimethyl-14-prop-1-en-2-yltetracyclo[9.2.1.04,12.08,12]tetradeca-3,6-diene-2,13-dione.
| Compound Name | (1R,5R,8R,9R,11R,12S,14S)-3-hydroxy-1,5,9-trimethyl-14-prop-1-en-2-yltetracyclo[9.2.1.04,12.08,12]tetradeca-3,6-diene-2,13-dione |
|---|---|
| PubChem CID | 134932462 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (1R,5R,8R,9R,11R,12S,14S)-3-hydroxy-1,5,9-trimethyl-14-prop-1-en-2-yltetracyclo[9.2.1.04,12.08,12]tetradeca-3,6-diene-2,13-dione |
| SMILES | C=C(C)[C@@H]1[C@H]2C[C@@H](C)[C@@H]3C=C[C@@H](C)C4=C(O)C(=O)[C@@]1(C)C(=O)[C@@]423 |
| InChI | InChI=1S/C20H24O3/c1-9(2)14-13-8-11(4)12-7-6-10(3)15-16(21)17(22)19(14,5)18(23)20(12,13)15/h6-7,10-14,21H,1,8H2,2-5H3/t10-,11-,12+,13-,14-,19+,20-/m1/s1 |
| InChIKey | XLNAGZAHVLWZQR-MHEULIARSA-N |
| XLogP | 3.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|