C20H26O3 — CID 135003444
(5S,8R,10R,11S,14R)-3-hydroxy-1,5,10-trimethyl-14-prop-1-en-2-yltetracyclo[9.2.1.04,12.08,12]tetradec-3-ene-2,13-dione (PubChem CID 135003444) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (5S,8R,10R,11S,14R)-3-hydroxy-1,5,10-trimethyl-14-prop-1-en-2-yltetracyclo[9.2.1.04,12.08,12]tetradec-3-ene-2,13-dione.
| Compound Name | (5S,8R,10R,11S,14R)-3-hydroxy-1,5,10-trimethyl-14-prop-1-en-2-yltetracyclo[9.2.1.04,12.08,12]tetradec-3-ene-2,13-dione |
|---|---|
| PubChem CID | 135003444 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (5S,8R,10R,11S,14R)-3-hydroxy-1,5,10-trimethyl-14-prop-1-en-2-yltetracyclo[9.2.1.04,12.08,12]tetradec-3-ene-2,13-dione |
| SMILES | C=C(C)[C@H]1[C@@H]2[C@H](C)C[C@H]3CC[C@H](C)C4=C(O)C(=O)C1(C)C(=O)C432 |
| InChI | InChI=1S/C20H26O3/c1-9(2)13-14-11(4)8-12-7-6-10(3)15-16(21)17(22)19(13,5)18(23)20(12,14)15/h10-14,21H,1,6-8H2,2-5H3/t10-,11+,12+,13-,14-,19?,20?/m0/s1 |
| InChIKey | OOQXYEHYWAADMU-GQHMHWCESA-N |
| XLogP | 3.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|