C30H40O6 — CID 154718141
(1R,2S,7S,8S)-4,10-dihydroxy-2,11-dimethyl-5,8-bis[(2R)-6-methylhept-5-en-2-yl]tricyclo[6.3.1.02,7]dodeca-4,10-diene-3,6,9,12-tetrone (PubChem CID 154718141) has the molecular formula C30H40O6 and a molecular weight of 496.64 g/mol. Its IUPAC name is (1R,2S,7S,8S)-4,10-dihydroxy-2,11-dimethyl-5,8-bis[(2R)-6-methylhept-5-en-2-yl]tricyclo[6.3.1.02,7]dodeca-4,10-diene-3,6,9,12-tetrone.
| Compound Name | (1R,2S,7S,8S)-4,10-dihydroxy-2,11-dimethyl-5,8-bis[(2R)-6-methylhept-5-en-2-yl]tricyclo[6.3.1.02,7]dodeca-4,10-diene-3,6,9,12-tetrone |
|---|---|
| PubChem CID | 154718141 |
| Molecular Formula | C30H40O6 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | (1R,2S,7S,8S)-4,10-dihydroxy-2,11-dimethyl-5,8-bis[(2R)-6-methylhept-5-en-2-yl]tricyclo[6.3.1.02,7]dodeca-4,10-diene-3,6,9,12-tetrone |
| SMILES | CC(C)=CCC[C@@H](C)C1=C(O)C(=O)[C@@]2(C)[C@@H]3C(=O)[C@@]([C@H](C)CCC=C(C)C)(C(=O)C(O)=C3C)[C@H]2C1=O |
| InChI | InChI=1S/C30H40O6/c1-15(2)11-9-13-17(5)20-23(32)25-29(8,27(35)24(20)33)21-19(7)22(31)28(36)30(25,26(21)34)18(6)14-10-12-16(3)4/h11-12,17-18,21,25,31,33H,9-10,13-14H2,1-8H3/t17-,18-,21+,25+,29+,30+/m1/s1 |
| InChIKey | YMBZAURIIJQQTD-LLTONEINSA-N |
| XLogP | 5.94 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|