C15H18O4 — CID 139053895
(1S,2R,6R,8S)-10-hydroxy-2,6,9-trimethyltricyclo[6.3.1.01,6]dodec-9-ene-5,11,12-trione (PubChem CID 139053895) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is (1S,2R,6R,8S)-10-hydroxy-2,6,9-trimethyltricyclo[6.3.1.01,6]dodec-9-ene-5,11,12-trione.
| Compound Name | (1S,2R,6R,8S)-10-hydroxy-2,6,9-trimethyltricyclo[6.3.1.01,6]dodec-9-ene-5,11,12-trione |
|---|---|
| PubChem CID | 139053895 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (1S,2R,6R,8S)-10-hydroxy-2,6,9-trimethyltricyclo[6.3.1.01,6]dodec-9-ene-5,11,12-trione |
| SMILES | CC1=C(O)C(=O)[C@]23C(=O)[C@H]1C[C@@]2(C)C(=O)CC[C@H]3C |
| InChI | InChI=1S/C15H18O4/c1-7-4-5-10(16)14(3)6-9-8(2)11(17)13(19)15(7,14)12(9)18/h7,9,17H,4-6H2,1-3H3/t7-,9+,14+,15+/m1/s1 |
| InChIKey | NCCGDCVQEBLKNP-ZWZLLUCSSA-N |
| XLogP | 1.98 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|