C28H26O8 — CID 163044467
(1R,2S,3S,4S,9S,13S,18R,19S)-2,7,16-trihydroxy-6,15,19-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]hexacyclo[10.7.1.03,18.04,9.09,13.013,18]icosa-6,12(20),15-triene-5,8,11,14,17-pentone (PubChem CID 163044467) has the molecular formula C28H26O8 and a molecular weight of 490.51 g/mol. Its IUPAC name is (1R,2S,3S,4S,9S,13S,18R,19S)-2,7,16-trihydroxy-6,15,19-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]hexacyclo[10.7.1.03,18.04,9.09,13.013,18]icosa-6,12(20),15-triene-5,8,11,14,17-pentone.
| Compound Name | (1R,2S,3S,4S,9S,13S,18R,19S)-2,7,16-trihydroxy-6,15,19-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]hexacyclo[10.7.1.03,18.04,9.09,13.013,18]icosa-6,12(20),15-triene-5,8,11,14,17-pentone |
|---|---|
| PubChem CID | 163044467 |
| Molecular Formula | C28H26O8 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | (1R,2S,3S,4S,9S,13S,18R,19S)-2,7,16-trihydroxy-6,15,19-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]hexacyclo[10.7.1.03,18.04,9.09,13.013,18]icosa-6,12(20),15-triene-5,8,11,14,17-pentone |
| SMILES | C/C=C/C=C/[C@]1(O)[C@@H]2C=C3C(=O)C[C@]45C(=O)C(O)=C(C)C(=O)[C@H]4[C@H]1[C@]1(C(=O)C(O)=C(C)C(=O)[C@]315)[C@H]2C |
| InChI | InChI=1S/C28H26O8/c1-5-6-7-8-26(36)14-9-15-16(29)10-25-17(18(30)11(2)19(31)23(25)34)21(26)27(13(14)4)24(35)20(32)12(3)22(33)28(15,25)27/h5-9,13-14,17,21,31-32,36H,10H2,1-4H3/b6-5+,8-7+/t13-,14+,17-,21+,25+,26-,27-,28-/m0/s1 |
| InChIKey | QKNJDMWFQJHKLS-WZAPWELSSA-N |
| XLogP | 2.20 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|