C21H28O3 — CID 134939417
(1S,5S,7S,8R,9S,14S)-12-methoxy-3,7,11,14-tetramethyltetracyclo[6.5.3.01,9.05,9]hexadeca-3,11-diene-10,13-dione (PubChem CID 134939417) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (1S,5S,7S,8R,9S,14S)-12-methoxy-3,7,11,14-tetramethyltetracyclo[6.5.3.01,9.05,9]hexadeca-3,11-diene-10,13-dione.
| Compound Name | (1S,5S,7S,8R,9S,14S)-12-methoxy-3,7,11,14-tetramethyltetracyclo[6.5.3.01,9.05,9]hexadeca-3,11-diene-10,13-dione |
|---|---|
| PubChem CID | 134939417 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (1S,5S,7S,8R,9S,14S)-12-methoxy-3,7,11,14-tetramethyltetracyclo[6.5.3.01,9.05,9]hexadeca-3,11-diene-10,13-dione |
| SMILES | COC1=C(C)C(=O)[C@@]23[C@@H]4C=C(C)C[C@]2(C1=O)[C@@H](C)CC[C@@H]3[C@@H](C)C4 |
| InChI | InChI=1S/C21H28O3/c1-11-8-15-9-12(2)16-7-6-13(3)20(10-11)19(23)17(24-5)14(4)18(22)21(15,16)20/h8,12-13,15-16H,6-7,9-10H2,1-5H3/t12-,13-,15+,16+,20+,21-/m0/s1 |
| InChIKey | IDLZCQBSPGYHCV-QWHWVPJHSA-N |
| XLogP | 4.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|