C10H21N3O — CID 10219838
2,6-diamino-1-pyrrolidin-1-ylhexan-1-one (PubChem CID 10219838) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 2,6-diamino-1-pyrrolidin-1-ylhexan-1-one.
| Compound Name | 2,6-diamino-1-pyrrolidin-1-ylhexan-1-one |
|---|---|
| PubChem CID | 10219838 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 2,6-diamino-1-pyrrolidin-1-ylhexan-1-one |
| SMILES | NCCCCC(N)C(=O)N1CCCC1 |
| InChI | InChI=1S/C10H21N3O/c11-6-2-1-5-9(12)10(14)13-7-3-4-8-13/h9H,1-8,11-12H2 |
| InChIKey | NERFQQPUBDASEO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|