C24H28N2O2 — CID 102199067
4-[2,5-bis[[(2R)-butan-2-yl]oxy]-4-pyridin-4-ylphenyl]pyridine (PubChem CID 102199067) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-[2,5-bis[[(2R)-butan-2-yl]oxy]-4-pyridin-4-ylphenyl]pyridine.
| Compound Name | 4-[2,5-bis[[(2R)-butan-2-yl]oxy]-4-pyridin-4-ylphenyl]pyridine |
|---|---|
| PubChem CID | 102199067 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 4-[2,5-bis[[(2R)-butan-2-yl]oxy]-4-pyridin-4-ylphenyl]pyridine |
| SMILES | CC[C@@H](C)Oc1cc(-c2ccncc2)c(O[C@H](C)CC)cc1-c1ccncc1 |
| InChI | InChI=1S/C24H28N2O2/c1-5-17(3)27-23-15-22(20-9-13-26-14-10-20)24(28-18(4)6-2)16-21(23)19-7-11-25-12-8-19/h7-18H,5-6H2,1-4H3/t17-,18-/m1/s1 |
| InChIKey | XYBWBUTYNJYJHU-QZTJIDSGSA-N |
| XLogP | 6.17 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |