C59H32F8N4 — CID 102199116
2-N',2-N',7-N',7-N'-tetraphenyl-2,7-bis(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2',7'-diamine (PubChem CID 102199116) has the molecular formula C59H32F8N4 and a molecular weight of 948.92 g/mol. Its IUPAC name is 2-N',2-N',7-N',7-N'-tetraphenyl-2,7-bis(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2',7'-diamine.
| Compound Name | 2-N',2-N',7-N',7-N'-tetraphenyl-2,7-bis(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2',7'-diamine |
|---|---|
| PubChem CID | 102199116 |
| Molecular Formula | C59H32F8N4 |
| Molecular Weight | 948.92 g/mol |
| Exact Mass | 948.25 |
| IUPAC Name | 2-N',2-N',7-N',7-N'-tetraphenyl-2,7-bis(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2',7'-diamine |
| SMILES | Fc1nc(F)c(F)c(-c2ccc3c(c2)C2(c4cc(-c5c(F)c(F)nc(F)c5F)ccc4-3)c3cc(N(c4ccccc4)c4ccccc4)ccc3-c3ccc(N(c4ccccc4)c4ccccc4)cc32)c1F |
| InChI | InChI=1S/C59H32F8N4/c60-51-49(52(61)56(65)68-55(51)64)33-21-25-41-42-26-22-34(50-53(62)57(66)69-58(67)54(50)63)30-46(42)59(45(41)29-33)47-31-39(70(35-13-5-1-6-14-35)36-15-7-2-8-16-36)23-27-43(47)44-28-24-40(32-48(44)59)71(37-17-9-3-10-18-37)38-19-11-4-12-20-38/h1-32H |
| InChIKey | QVXBQWLAMZSUJH-UHFFFAOYSA-N |
| XLogP | 16.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.92 |
| LogP ≤ 5 | 16.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|