C35H14F8N2 — CID 139183203
2,3,5,6-tetrafluoro-4-[7'-(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2'-yl]pyridine (PubChem CID 139183203) has the molecular formula C35H14F8N2 and a molecular weight of 614.49 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[7'-(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2'-yl]pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-[7'-(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2'-yl]pyridine |
|---|---|
| PubChem CID | 139183203 |
| Molecular Formula | C35H14F8N2 |
| Molecular Weight | 614.49 g/mol |
| Exact Mass | 614.10 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[7'-(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2'-yl]pyridine |
| SMILES | Fc1nc(F)c(F)c(-c2ccc3c(c2)C2(c4ccccc4-c4ccccc42)c2cc(-c4c(F)c(F)nc(F)c4F)ccc2-3)c1F |
| InChI | InChI=1S/C35H14F8N2/c36-27-25(28(37)32(41)44-31(27)40)15-9-11-19-20-12-10-16(26-29(38)33(42)45-34(43)30(26)39)14-24(20)35(23(19)13-15)21-7-3-1-5-17(21)18-6-2-4-8-22(18)35/h1-14H |
| InChIKey | KYTLLSQQXHKCHP-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.49 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|