C19H8F4N2 — CID 14315791
9-(2,3,5,6-tetrafluoro-4-pyridinyl)fluorene-9-carbonitrile (PubChem CID 14315791) has the molecular formula C19H8F4N2 and a molecular weight of 340.28 g/mol. Its IUPAC name is 9-(2,3,5,6-tetrafluoro-4-pyridinyl)fluorene-9-carbonitrile.
| Compound Name | 9-(2,3,5,6-tetrafluoro-4-pyridinyl)fluorene-9-carbonitrile |
|---|---|
| PubChem CID | 14315791 |
| Molecular Formula | C19H8F4N2 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 9-(2,3,5,6-tetrafluoro-4-pyridinyl)fluorene-9-carbonitrile |
| SMILES | N#CC1(c2c(F)c(F)nc(F)c2F)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H8F4N2/c20-15-14(16(21)18(23)25-17(15)22)19(9-24)12-7-3-1-5-10(12)11-6-2-4-8-13(11)19/h1-8H |
| InChIKey | BLTVNQYUFDNCDP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|