C14H8F4N2 — CID 12949947
2-phenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)propanenitrile (PubChem CID 12949947) has the molecular formula C14H8F4N2 and a molecular weight of 280.22 g/mol. Its IUPAC name is 2-phenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)propanenitrile.
| Compound Name | 2-phenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)propanenitrile |
|---|---|
| PubChem CID | 12949947 |
| Molecular Formula | C14H8F4N2 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-phenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)propanenitrile |
| SMILES | CC(C#N)(c1ccccc1)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C14H8F4N2/c1-14(7-19,8-5-3-2-4-6-8)9-10(15)12(17)20-13(18)11(9)16/h2-6H,1H3 |
| InChIKey | RFECINBCFUWOQG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|