C18H11F4NO — CID 23233940
diphenyl-(2,3,5,6-tetrafluoro-4-pyridinyl)methanol (PubChem CID 23233940) has the molecular formula C18H11F4NO and a molecular weight of 333.28 g/mol. Its IUPAC name is diphenyl-(2,3,5,6-tetrafluoro-4-pyridinyl)methanol.
| Compound Name | diphenyl-(2,3,5,6-tetrafluoro-4-pyridinyl)methanol |
|---|---|
| PubChem CID | 23233940 |
| Molecular Formula | C18H11F4NO |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | diphenyl-(2,3,5,6-tetrafluoro-4-pyridinyl)methanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C18H11F4NO/c19-14-13(15(20)17(22)23-16(14)21)18(24,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,24H |
| InChIKey | FDRPGIAOWPJERL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|