C19H10F4N2 — CID 5221082
2,2-diphenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetonitrile (PubChem CID 5221082) has the molecular formula C19H10F4N2 and a molecular weight of 342.30 g/mol. Its IUPAC name is 2,2-diphenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetonitrile.
| Compound Name | 2,2-diphenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetonitrile |
|---|---|
| PubChem CID | 5221082 |
| Molecular Formula | C19H10F4N2 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2,2-diphenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetonitrile |
| SMILES | N#CC(c1ccccc1)(c1ccccc1)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C19H10F4N2/c20-15-14(16(21)18(23)25-17(15)22)19(11-24,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H |
| InChIKey | DESFNBLSLMTSIL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|