C18H13N3 — CID 18994305
2,2-diphenyl-2-pyrimidin-5-ylacetonitrile (PubChem CID 18994305) has the molecular formula C18H13N3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2,2-diphenyl-2-pyrimidin-5-ylacetonitrile.
| Compound Name | 2,2-diphenyl-2-pyrimidin-5-ylacetonitrile |
|---|---|
| PubChem CID | 18994305 |
| Molecular Formula | C18H13N3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2,2-diphenyl-2-pyrimidin-5-ylacetonitrile |
| SMILES | N#CC(c1ccccc1)(c1ccccc1)c1cncnc1 |
| InChI | InChI=1S/C18H13N3/c19-13-18(15-7-3-1-4-8-15,16-9-5-2-6-10-16)17-11-20-14-21-12-17/h1-12,14H |
| InChIKey | KMCQFASPVZWZOB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |