About tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene
tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene (PubChem CID 158723352) has the molecular formula C26H38N2S
and a molecular weight of 410.67 g/mol. Its IUPAC name is tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene.
Molecular Properties
| Compound Name | tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene |
| PubChem CID | 158723352 |
| Molecular Formula | C26H38N2S |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene |
| SMILES | CC(C)(C)c1ccccc1.CC(C)(C)c1cccs1.CC(C)(C)c1cncnc1 |
| InChI | InChI=1S/C10H14.C8H12N2.C8H12S/c1-10(2,3)9-7-5-4-6-8-9;1-8(2,3)7-4-9-6-10-5-7;1-8(2,3)7-5-4-6-9-7/h4-8H,1-3H3;4-6H,1-3H3;4-6H,1-3H3 |
| InChIKey | IKEOKZBGSWCUEA-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene?
The IUPAC name of tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene (CID 158723352) is tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene.
What is the SMILES notation for tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene?
The canonical SMILES for tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene is CC(C)(C)c1ccccc1.CC(C)(C)c1cccs1.CC(C)(C)c1cncnc1.
What is the InChIKey of tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene?
The InChIKey is IKEOKZBGSWCUEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C8H12N2.C8H12S/c1-10(2,3)9-7-5-4-6-8-9;1-8(2,3)7-4-9-6-10-5-7;1-8(2,3)7-5-4-6-9-7/h4-8H,1-3H3;4-6H,1-3H3;4-6H,1-3H3.
What are the key properties of tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene?
tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene has a molecular weight of 410.67 g/mol, XLogP of 7.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylbenzene;5-tert-butylpyrimidine;2-tert-butylthiophene is sourced from PubChem (CID 158723352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).