C17H10F3N — CID 138963207
2,4,6-trifluoro-3,5-diphenylpyridine (PubChem CID 138963207) has the molecular formula C17H10F3N and a molecular weight of 285.27 g/mol. Its IUPAC name is 2,4,6-trifluoro-3,5-diphenylpyridine.
| Compound Name | 2,4,6-trifluoro-3,5-diphenylpyridine |
|---|---|
| PubChem CID | 138963207 |
| Molecular Formula | C17H10F3N |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2,4,6-trifluoro-3,5-diphenylpyridine |
| SMILES | Fc1nc(F)c(-c2ccccc2)c(F)c1-c1ccccc1 |
| InChI | InChI=1S/C17H10F3N/c18-15-13(11-7-3-1-4-8-11)16(19)21-17(20)14(15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | ITBRVWJUIREGHI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|