C35H12Br2F8N2 — CID 139183206
4-[2',7'-dibromo-7-(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2-yl]-2,3,5,6-tetrafluoropyridine (PubChem CID 139183206) has the molecular formula C35H12Br2F8N2 and a molecular weight of 772.29 g/mol. Its IUPAC name is 4-[2',7'-dibromo-7-(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2-yl]-2,3,5,6-tetrafluoropyridine.
| Compound Name | 4-[2',7'-dibromo-7-(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2-yl]-2,3,5,6-tetrafluoropyridine |
|---|---|
| PubChem CID | 139183206 |
| Molecular Formula | C35H12Br2F8N2 |
| Molecular Weight | 772.29 g/mol |
| Exact Mass | 769.92 |
| IUPAC Name | 4-[2',7'-dibromo-7-(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2-yl]-2,3,5,6-tetrafluoropyridine |
| SMILES | Fc1nc(F)c(F)c(-c2ccc3c(c2)C2(c4cc(Br)ccc4-c4ccc(Br)cc42)c2cc(-c4c(F)c(F)nc(F)c4F)ccc2-3)c1F |
| InChI | InChI=1S/C35H12Br2F8N2/c36-15-3-7-19-20-8-4-16(37)12-24(20)35(23(19)11-15)21-9-13(25-27(38)31(42)46-32(43)28(25)39)1-5-17(21)18-6-2-14(10-22(18)35)26-29(40)33(44)47-34(45)30(26)41/h1-12H |
| InChIKey | XKUFBHWBKNQFCN-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.29 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|