C70H24Br4F16N4 — CID 139183205
4-[2',7'-dibromo-7-(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2-yl]-2,3,5,6-tetrafluoropyridine (PubChem CID 139183205) has the molecular formula C70H24Br4F16N4 and a molecular weight of 1544.57 g/mol. Its IUPAC name is 4-[2',7'-dibromo-7-(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2-yl]-2,3,5,6-tetrafluoropyridine.
| Compound Name | 4-[2',7'-dibromo-7-(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2-yl]-2,3,5,6-tetrafluoropyridine |
|---|---|
| PubChem CID | 139183205 |
| Molecular Formula | C70H24Br4F16N4 |
| Molecular Weight | 1544.57 g/mol |
| Exact Mass | 1539.85 |
| IUPAC Name | 4-[2',7'-dibromo-7-(2,3,5,6-tetrafluoro-4-pyridinyl)-9,9'-spirobi[fluorene]-2-yl]-2,3,5,6-tetrafluoropyridine |
| SMILES | Fc1nc(F)c(F)c(-c2ccc3c(c2)C2(c4cc(Br)ccc4-c4ccc(Br)cc42)c2cc(-c4c(F)c(F)nc(F)c4F)ccc2-3)c1F.Fc1nc(F)c(F)c(-c2ccc3c(c2)C2(c4cc(Br)ccc4-c4ccc(Br)cc42)c2cc(-c4c(F)c(F)nc(F)c4F)ccc2-3)c1F |
| InChI | InChI=1S/2C35H12Br2F8N2/c2*36-15-3-7-19-20-8-4-16(37)12-24(20)35(23(19)11-15)21-9-13(25-27(38)31(42)46-32(43)28(25)39)1-5-17(21)18-6-2-14(10-22(18)35)26-29(40)33(44)47-34(45)30(26)41/h2*1-12H |
| InChIKey | QVIMGVNIPCNSBT-UHFFFAOYSA-N |
| XLogP | 21.58 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1544.57 |
| LogP ≤ 5 | 21.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|