C22H12F8N2 — CID 139120034
4-[[5,6-dimethyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)-3H-inden-1-yl]methyl]-2,3,5,6-tetrafluoropyridine (PubChem CID 139120034) has the molecular formula C22H12F8N2 and a molecular weight of 456.34 g/mol. Its IUPAC name is 4-[[5,6-dimethyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)-3H-inden-1-yl]methyl]-2,3,5,6-tetrafluoropyridine.
| Compound Name | 4-[[5,6-dimethyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)-3H-inden-1-yl]methyl]-2,3,5,6-tetrafluoropyridine |
|---|---|
| PubChem CID | 139120034 |
| Molecular Formula | C22H12F8N2 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 4-[[5,6-dimethyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)-3H-inden-1-yl]methyl]-2,3,5,6-tetrafluoropyridine |
| SMILES | Cc1cc2c(cc1C)C(Cc1c(F)c(F)nc(F)c1F)=C(c1c(F)c(F)nc(F)c1F)C2 |
| InChI | InChI=1S/C22H12F8N2/c1-7-3-9-5-12(14-17(25)21(29)32-22(30)18(14)26)11(10(9)4-8(7)2)6-13-15(23)19(27)31-20(28)16(13)24/h3-4H,5-6H2,1-2H3 |
| InChIKey | FZIQUUJBAYMBJV-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|